C8H11BrN4O3S — CID 171806539
ethyl N-[[4-bromo-5-(hydroxymethyl)-1H-pyrazol-3-yl]carbamothioyl]carbamate (PubChem CID 171806539) has the molecular formula C8H11BrN4O3S and a molecular weight of 323.17 g/mol. Its IUPAC name is ethyl N-[[4-bromo-5-(hydroxymethyl)-1H-pyrazol-3-yl]carbamothioyl]carbamate.
| Compound Name | ethyl N-[[4-bromo-5-(hydroxymethyl)-1H-pyrazol-3-yl]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 171806539 |
| Molecular Formula | C8H11BrN4O3S |
| Molecular Weight | 323.17 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | ethyl N-[[4-bromo-5-(hydroxymethyl)-1H-pyrazol-3-yl]carbamothioyl]carbamate |
| SMILES | CCOC(=O)NC(=S)Nc1n[nH]c(CO)c1Br |
| InChI | InChI=1S/C8H11BrN4O3S/c1-2-16-8(15)11-7(17)10-6-5(9)4(3-14)12-13-6/h14H,2-3H2,1H3,(H3,10,11,12,13,15,17) |
| InChIKey | FVWKCJRRGXADPO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.17 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|