C14H13F3N4O2S — CID 162539884
ethyl N-[[4-[4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]carbamothioyl]carbamate (PubChem CID 162539884) has the molecular formula C14H13F3N4O2S and a molecular weight of 358.35 g/mol. Its IUPAC name is ethyl N-[[4-[4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]carbamothioyl]carbamate.
| Compound Name | ethyl N-[[4-[4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 162539884 |
| Molecular Formula | C14H13F3N4O2S |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | ethyl N-[[4-[4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]carbamothioyl]carbamate |
| SMILES | CCOC(=O)NC(=S)Nc1[nH]ncc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F3N4O2S/c1-2-23-13(22)20-12(24)19-11-10(7-18-21-11)8-3-5-9(6-4-8)14(15,16)17/h3-7H,2H2,1H3,(H3,18,19,20,21,22,24) |
| InChIKey | GGJLAALAZLQILO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|