C7H11N3O2 — CID 115630334
ethyl N-(4-methyl-1H-pyrazol-5-yl)carbamate (PubChem CID 115630334) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is ethyl N-(4-methyl-1H-pyrazol-5-yl)carbamate.
| Compound Name | ethyl N-(4-methyl-1H-pyrazol-5-yl)carbamate |
|---|---|
| PubChem CID | 115630334 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | ethyl N-(4-methyl-1H-pyrazol-5-yl)carbamate |
| SMILES | CCOC(=O)Nc1[nH]ncc1C |
| InChI | InChI=1S/C7H11N3O2/c1-3-12-7(11)9-6-5(2)4-8-10-6/h4H,3H2,1-2H3,(H2,8,9,10,11) |
| InChIKey | OIRCVVYNCUEAMY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |