C6H10N4O — CID 104620558
1-methyl-3-(4-methyl-1H-pyrazol-5-yl)urea (PubChem CID 104620558) has the molecular formula C6H10N4O and a molecular weight of 154.17 g/mol. Its IUPAC name is 1-methyl-3-(4-methyl-1H-pyrazol-5-yl)urea.
| Compound Name | 1-methyl-3-(4-methyl-1H-pyrazol-5-yl)urea |
|---|---|
| PubChem CID | 104620558 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 1-methyl-3-(4-methyl-1H-pyrazol-5-yl)urea |
| SMILES | CNC(=O)Nc1[nH]ncc1C |
| InChI | InChI=1S/C6H10N4O/c1-4-3-8-10-5(4)9-6(11)7-2/h3H,1-2H3,(H3,7,8,9,10,11) |
| InChIKey | QEXVPDPKNFZLPG-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |