C11H15N3O — CID 104620156
N-(4-methyl-1H-pyrazol-5-yl)bicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 104620156) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is N-(4-methyl-1H-pyrazol-5-yl)bicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | N-(4-methyl-1H-pyrazol-5-yl)bicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 104620156 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | N-(4-methyl-1H-pyrazol-5-yl)bicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | Cc1cn[nH]c1NC(=O)C1CC2CC2C1 |
| InChI | InChI=1S/C11H15N3O/c1-6-5-12-14-10(6)13-11(15)9-3-7-2-8(7)4-9/h5,7-9H,2-4H2,1H3,(H2,12,13,14,15) |
| InChIKey | QCLZEVRZOBUICK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |