C11H9Cl2N3O — CID 112691317
2,5-dichloro-N-(4-methyl-1H-pyrazol-5-yl)benzamide (PubChem CID 112691317) has the molecular formula C11H9Cl2N3O and a molecular weight of 270.12 g/mol. Its IUPAC name is 2,5-dichloro-N-(4-methyl-1H-pyrazol-5-yl)benzamide.
| Compound Name | 2,5-dichloro-N-(4-methyl-1H-pyrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 112691317 |
| Molecular Formula | C11H9Cl2N3O |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 2,5-dichloro-N-(4-methyl-1H-pyrazol-5-yl)benzamide |
| SMILES | Cc1cn[nH]c1NC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H9Cl2N3O/c1-6-5-14-16-10(6)15-11(17)8-4-7(12)2-3-9(8)13/h2-5H,1H3,(H2,14,15,16,17) |
| InChIKey | FCCNQLSKXNUZTH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |