C13H11Cl2N3O — CID 670750
2,5-dichloro-N-(4,6-dimethylpyrimidin-2-yl)benzamide (PubChem CID 670750) has the molecular formula C13H11Cl2N3O and a molecular weight of 296.16 g/mol. Its IUPAC name is 2,5-dichloro-N-(4,6-dimethylpyrimidin-2-yl)benzamide.
| Compound Name | 2,5-dichloro-N-(4,6-dimethylpyrimidin-2-yl)benzamide |
|---|---|
| PubChem CID | 670750 |
| Molecular Formula | C13H11Cl2N3O |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 2,5-dichloro-N-(4,6-dimethylpyrimidin-2-yl)benzamide |
| SMILES | Cc1cc(C)nc(NC(=O)c2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C13H11Cl2N3O/c1-7-5-8(2)17-13(16-7)18-12(19)10-6-9(14)3-4-11(10)15/h3-6H,1-2H3,(H,16,17,18,19) |
| InChIKey | COCFRXZQRWHCST-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |