C15H17ClN4O — CID 62185060
5-chloro-N-(4,6-dimethylpyrimidin-2-yl)-2-(ethylamino)benzamide (PubChem CID 62185060) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)-2-(ethylamino)benzamide.
| Compound Name | 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)-2-(ethylamino)benzamide |
|---|---|
| PubChem CID | 62185060 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)-2-(ethylamino)benzamide |
| SMILES | CCNc1ccc(Cl)cc1C(=O)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C15H17ClN4O/c1-4-17-13-6-5-11(16)8-12(13)14(21)20-15-18-9(2)7-10(3)19-15/h5-8,17H,4H2,1-3H3,(H,18,19,20,21) |
| InChIKey | DWYYIJHRAHVCNL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |