C10H13N3O3S — CID 11379829
ethyl N-[(3-methoxy-2-pyridinyl)carbamothioyl]carbamate (PubChem CID 11379829) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is ethyl N-[(3-methoxy-2-pyridinyl)carbamothioyl]carbamate.
| Compound Name | ethyl N-[(3-methoxy-2-pyridinyl)carbamothioyl]carbamate |
|---|---|
| PubChem CID | 11379829 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | ethyl N-[(3-methoxy-2-pyridinyl)carbamothioyl]carbamate |
| SMILES | CCOC(=O)NC(=S)Nc1ncccc1OC |
| InChI | InChI=1S/C10H13N3O3S/c1-3-16-10(14)13-9(17)12-8-7(15-2)5-4-6-11-8/h4-6H,3H2,1-2H3,(H2,11,12,13,14,17) |
| InChIKey | HVGDTXRMGSMOOG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|