C17H21N3O4S — CID 100667189
1-(3-methoxy-2-pyridinyl)-3-[(2,3,4-trimethoxyphenyl)methyl]thiourea (PubChem CID 100667189) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is 1-(3-methoxy-2-pyridinyl)-3-[(2,3,4-trimethoxyphenyl)methyl]thiourea.
| Compound Name | 1-(3-methoxy-2-pyridinyl)-3-[(2,3,4-trimethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100667189 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 1-(3-methoxy-2-pyridinyl)-3-[(2,3,4-trimethoxyphenyl)methyl]thiourea |
| SMILES | COc1cccnc1NC(=S)NCc1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C17H21N3O4S/c1-21-12-8-7-11(14(23-3)15(12)24-4)10-19-17(25)20-16-13(22-2)6-5-9-18-16/h5-9H,10H2,1-4H3,(H2,18,19,20,25) |
| InChIKey | UVIZUVFYXIPBEM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 73.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|