C16H19N3O3S — CID 100667143
1-pyridin-3-yl-3-[(2,3,4-trimethoxyphenyl)methyl]thiourea (PubChem CID 100667143) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 1-pyridin-3-yl-3-[(2,3,4-trimethoxyphenyl)methyl]thiourea.
| Compound Name | 1-pyridin-3-yl-3-[(2,3,4-trimethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100667143 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 1-pyridin-3-yl-3-[(2,3,4-trimethoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)Nc2cccnc2)c(OC)c1OC |
| InChI | InChI=1S/C16H19N3O3S/c1-20-13-7-6-11(14(21-2)15(13)22-3)9-18-16(23)19-12-5-4-8-17-10-12/h4-8,10H,9H2,1-3H3,(H2,18,19,23) |
| InChIKey | WWRBSSNASIMZEP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|