C16H17N3O2S — CID 940583
methyl 2-[4-(pyridin-3-ylmethylcarbamothioylamino)phenyl]acetate (PubChem CID 940583) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is methyl 2-[4-(pyridin-3-ylmethylcarbamothioylamino)phenyl]acetate.
| Compound Name | methyl 2-[4-(pyridin-3-ylmethylcarbamothioylamino)phenyl]acetate |
|---|---|
| PubChem CID | 940583 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | methyl 2-[4-(pyridin-3-ylmethylcarbamothioylamino)phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(NC(=S)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C16H17N3O2S/c1-21-15(20)9-12-4-6-14(7-5-12)19-16(22)18-11-13-3-2-8-17-10-13/h2-8,10H,9,11H2,1H3,(H2,18,19,22) |
| InChIKey | SSJVNSFDLNOFNX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|