C17H16N4OS — CID 100596129
1-(8-methoxyquinolin-5-yl)-3-(pyridin-3-ylmethyl)thiourea (PubChem CID 100596129) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-(8-methoxyquinolin-5-yl)-3-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-(8-methoxyquinolin-5-yl)-3-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 100596129 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 1-(8-methoxyquinolin-5-yl)-3-(pyridin-3-ylmethyl)thiourea |
| SMILES | COc1ccc(NC(=S)NCc2cccnc2)c2cccnc12 |
| InChI | InChI=1S/C17H16N4OS/c1-22-15-7-6-14(13-5-3-9-19-16(13)15)21-17(23)20-11-12-4-2-8-18-10-12/h2-10H,11H2,1H3,(H2,20,21,23) |
| InChIKey | FOJISIURZIROSW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|