C24H27N3OS — CID 100773086
1-(8-methoxyquinolin-5-yl)-3-[1-(2-phenylethyl)cyclopentyl]thiourea (PubChem CID 100773086) has the molecular formula C24H27N3OS and a molecular weight of 405.57 g/mol. Its IUPAC name is 1-(8-methoxyquinolin-5-yl)-3-[1-(2-phenylethyl)cyclopentyl]thiourea.
| Compound Name | 1-(8-methoxyquinolin-5-yl)-3-[1-(2-phenylethyl)cyclopentyl]thiourea |
|---|---|
| PubChem CID | 100773086 |
| Molecular Formula | C24H27N3OS |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 1-(8-methoxyquinolin-5-yl)-3-[1-(2-phenylethyl)cyclopentyl]thiourea |
| SMILES | COc1ccc(NC(=S)NC2(CCc3ccccc3)CCCC2)c2cccnc12 |
| InChI | InChI=1S/C24H27N3OS/c1-28-21-12-11-20(19-10-7-17-25-22(19)21)26-23(29)27-24(14-5-6-15-24)16-13-18-8-3-2-4-9-18/h2-4,7-12,17H,5-6,13-16H2,1H3,(H2,26,27,29) |
| InChIKey | HYWJGPLQROJHHT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|