C21H23N3OS2 — CID 100689105
1-(8-methoxyquinolin-5-yl)-3-[3-(4-methylphenyl)sulfanylpropyl]thiourea (PubChem CID 100689105) has the molecular formula C21H23N3OS2 and a molecular weight of 397.57 g/mol. Its IUPAC name is 1-(8-methoxyquinolin-5-yl)-3-[3-(4-methylphenyl)sulfanylpropyl]thiourea.
| Compound Name | 1-(8-methoxyquinolin-5-yl)-3-[3-(4-methylphenyl)sulfanylpropyl]thiourea |
|---|---|
| PubChem CID | 100689105 |
| Molecular Formula | C21H23N3OS2 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 1-(8-methoxyquinolin-5-yl)-3-[3-(4-methylphenyl)sulfanylpropyl]thiourea |
| SMILES | COc1ccc(NC(=S)NCCCSc2ccc(C)cc2)c2cccnc12 |
| InChI | InChI=1S/C21H23N3OS2/c1-15-6-8-16(9-7-15)27-14-4-13-23-21(26)24-18-10-11-19(25-2)20-17(18)5-3-12-22-20/h3,5-12H,4,13-14H2,1-2H3,(H2,23,24,26) |
| InChIKey | QIZPSNLRLAWZNI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|