C26H25N3OS — CID 100747914
1-[(R)-(2,4-dimethylphenyl)-phenylmethyl]-3-(8-methoxyquinolin-5-yl)thiourea (PubChem CID 100747914) has the molecular formula C26H25N3OS and a molecular weight of 427.57 g/mol. Its IUPAC name is 1-[(R)-(2,4-dimethylphenyl)-phenylmethyl]-3-(8-methoxyquinolin-5-yl)thiourea.
| Compound Name | 1-[(R)-(2,4-dimethylphenyl)-phenylmethyl]-3-(8-methoxyquinolin-5-yl)thiourea |
|---|---|
| PubChem CID | 100747914 |
| Molecular Formula | C26H25N3OS |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 1-[(R)-(2,4-dimethylphenyl)-phenylmethyl]-3-(8-methoxyquinolin-5-yl)thiourea |
| SMILES | COc1ccc(NC(=S)N[C@H](c2ccccc2)c2ccc(C)cc2C)c2cccnc12 |
| InChI | InChI=1S/C26H25N3OS/c1-17-11-12-20(18(2)16-17)24(19-8-5-4-6-9-19)29-26(31)28-22-13-14-23(30-3)25-21(22)10-7-15-27-25/h4-16,24H,1-3H3,(H2,28,29,31)/t24-/m1/s1 |
| InChIKey | KBCLLCGMNVVOCQ-XMMPIXPASA-N |
| XLogP | 5.94 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|