C23H27N3OS — CID 133218234
1-[1-(2,4-dimethylphenyl)-2-methylpropyl]-3-(8-methoxyquinolin-5-yl)thiourea (PubChem CID 133218234) has the molecular formula C23H27N3OS and a molecular weight of 393.56 g/mol. Its IUPAC name is 1-[1-(2,4-dimethylphenyl)-2-methylpropyl]-3-(8-methoxyquinolin-5-yl)thiourea.
| Compound Name | 1-[1-(2,4-dimethylphenyl)-2-methylpropyl]-3-(8-methoxyquinolin-5-yl)thiourea |
|---|---|
| PubChem CID | 133218234 |
| Molecular Formula | C23H27N3OS |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-[1-(2,4-dimethylphenyl)-2-methylpropyl]-3-(8-methoxyquinolin-5-yl)thiourea |
| SMILES | COc1ccc(NC(=S)NC(c2ccc(C)cc2C)C(C)C)c2cccnc12 |
| InChI | InChI=1S/C23H27N3OS/c1-14(2)21(17-9-8-15(3)13-16(17)4)26-23(28)25-19-10-11-20(27-5)22-18(19)7-6-12-24-22/h6-14,21H,1-5H3,(H2,25,26,28) |
| InChIKey | JHLHTAUHFQXJKQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|