C19H23ClN2S — CID 100746421
1-(2-chlorophenyl)-3-[(1S)-1-(2,4-dimethylphenyl)-2-methylpropyl]thiourea (PubChem CID 100746421) has the molecular formula C19H23ClN2S and a molecular weight of 346.93 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[(1S)-1-(2,4-dimethylphenyl)-2-methylpropyl]thiourea.
| Compound Name | 1-(2-chlorophenyl)-3-[(1S)-1-(2,4-dimethylphenyl)-2-methylpropyl]thiourea |
|---|---|
| PubChem CID | 100746421 |
| Molecular Formula | C19H23ClN2S |
| Molecular Weight | 346.93 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[(1S)-1-(2,4-dimethylphenyl)-2-methylpropyl]thiourea |
| SMILES | Cc1ccc([C@@H](NC(=S)Nc2ccccc2Cl)C(C)C)c(C)c1 |
| InChI | InChI=1S/C19H23ClN2S/c1-12(2)18(15-10-9-13(3)11-14(15)4)22-19(23)21-17-8-6-5-7-16(17)20/h5-12,18H,1-4H3,(H2,21,22,23)/t18-/m0/s1 |
| InChIKey | MVTRGMMUDIBQBW-SFHVURJKSA-N |
| XLogP | 5.64 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.93 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|