C23H30N2O2S — CID 100746949
ethyl 3-[[(1S)-1-(2,4-dimethylphenyl)-2-methylpropyl]carbamothioylamino]-2-methylbenzoate (PubChem CID 100746949) has the molecular formula C23H30N2O2S and a molecular weight of 398.57 g/mol. Its IUPAC name is ethyl 3-[[(1S)-1-(2,4-dimethylphenyl)-2-methylpropyl]carbamothioylamino]-2-methylbenzoate.
| Compound Name | ethyl 3-[[(1S)-1-(2,4-dimethylphenyl)-2-methylpropyl]carbamothioylamino]-2-methylbenzoate |
|---|---|
| PubChem CID | 100746949 |
| Molecular Formula | C23H30N2O2S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | ethyl 3-[[(1S)-1-(2,4-dimethylphenyl)-2-methylpropyl]carbamothioylamino]-2-methylbenzoate |
| SMILES | CCOC(=O)c1cccc(NC(=S)N[C@H](c2ccc(C)cc2C)C(C)C)c1C |
| InChI | InChI=1S/C23H30N2O2S/c1-7-27-22(26)19-9-8-10-20(17(19)6)24-23(28)25-21(14(2)3)18-12-11-15(4)13-16(18)5/h8-14,21H,7H2,1-6H3,(H2,24,25,28)/t21-/m0/s1 |
| InChIKey | UWYKAPBDYBEKDT-NRFANRHFSA-N |
| XLogP | 5.47 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|