C23H30N2O3S — CID 100656864
ethyl 3-[[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]carbamothioylamino]-2-methylbenzoate (PubChem CID 100656864) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is ethyl 3-[[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]carbamothioylamino]-2-methylbenzoate.
| Compound Name | ethyl 3-[[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]carbamothioylamino]-2-methylbenzoate |
|---|---|
| PubChem CID | 100656864 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | ethyl 3-[[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]carbamothioylamino]-2-methylbenzoate |
| SMILES | CCOC(=O)c1cccc(NC(=S)N[C@@H](CC(C)C)c2ccc(OC)cc2)c1C |
| InChI | InChI=1S/C23H30N2O3S/c1-6-28-22(26)19-8-7-9-20(16(19)4)24-23(29)25-21(14-15(2)3)17-10-12-18(27-5)13-11-17/h7-13,15,21H,6,14H2,1-5H3,(H2,24,25,29)/t21-/m0/s1 |
| InChIKey | PFQMXCWCSDRYOM-NRFANRHFSA-N |
| XLogP | 5.25 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|