C23H30N2O2S — CID 133154925
ethyl 2-methyl-3-[(4-methyl-4-phenylpentan-2-yl)carbamothioylamino]benzoate (PubChem CID 133154925) has the molecular formula C23H30N2O2S and a molecular weight of 398.57 g/mol. Its IUPAC name is ethyl 2-methyl-3-[(4-methyl-4-phenylpentan-2-yl)carbamothioylamino]benzoate.
| Compound Name | ethyl 2-methyl-3-[(4-methyl-4-phenylpentan-2-yl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 133154925 |
| Molecular Formula | C23H30N2O2S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | ethyl 2-methyl-3-[(4-methyl-4-phenylpentan-2-yl)carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=S)NC(C)CC(C)(C)c2ccccc2)c1C |
| InChI | InChI=1S/C23H30N2O2S/c1-6-27-21(26)19-13-10-14-20(17(19)3)25-22(28)24-16(2)15-23(4,5)18-11-8-7-9-12-18/h7-14,16H,6,15H2,1-5H3,(H2,24,25,28) |
| InChIKey | AXGZFZQNFAMZBI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|