C20H26N2S — CID 100713378
1-(4-methylphenyl)-3-[(2R)-4-methyl-4-phenylpentan-2-yl]thiourea (PubChem CID 100713378) has the molecular formula C20H26N2S and a molecular weight of 326.51 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-[(2R)-4-methyl-4-phenylpentan-2-yl]thiourea.
| Compound Name | 1-(4-methylphenyl)-3-[(2R)-4-methyl-4-phenylpentan-2-yl]thiourea |
|---|---|
| PubChem CID | 100713378 |
| Molecular Formula | C20H26N2S |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 1-(4-methylphenyl)-3-[(2R)-4-methyl-4-phenylpentan-2-yl]thiourea |
| SMILES | Cc1ccc(NC(=S)N[C@H](C)CC(C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H26N2S/c1-15-10-12-18(13-11-15)22-19(23)21-16(2)14-20(3,4)17-8-6-5-7-9-17/h5-13,16H,14H2,1-4H3,(H2,21,22,23)/t16-/m1/s1 |
| InChIKey | ORYVVEDZAUYRMC-MRXNPFEDSA-N |
| XLogP | 5.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|