C19H23FN2S — CID 100713865
1-(3-fluorophenyl)-3-[(2S)-4-methyl-4-phenylpentan-2-yl]thiourea (PubChem CID 100713865) has the molecular formula C19H23FN2S and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[(2S)-4-methyl-4-phenylpentan-2-yl]thiourea.
| Compound Name | 1-(3-fluorophenyl)-3-[(2S)-4-methyl-4-phenylpentan-2-yl]thiourea |
|---|---|
| PubChem CID | 100713865 |
| Molecular Formula | C19H23FN2S |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[(2S)-4-methyl-4-phenylpentan-2-yl]thiourea |
| SMILES | C[C@@H](CC(C)(C)c1ccccc1)NC(=S)Nc1cccc(F)c1 |
| InChI | InChI=1S/C19H23FN2S/c1-14(13-19(2,3)15-8-5-4-6-9-15)21-18(23)22-17-11-7-10-16(20)12-17/h4-12,14H,13H2,1-3H3,(H2,21,22,23)/t14-/m0/s1 |
| InChIKey | BVIPKCRNOCGYQS-AWEZNQCLSA-N |
| XLogP | 4.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|