C24H32N2OS — CID 100714418
1-(4-cyclopentyloxyphenyl)-3-[(2R)-4-methyl-4-phenylpentan-2-yl]thiourea (PubChem CID 100714418) has the molecular formula C24H32N2OS and a molecular weight of 396.60 g/mol. Its IUPAC name is 1-(4-cyclopentyloxyphenyl)-3-[(2R)-4-methyl-4-phenylpentan-2-yl]thiourea.
| Compound Name | 1-(4-cyclopentyloxyphenyl)-3-[(2R)-4-methyl-4-phenylpentan-2-yl]thiourea |
|---|---|
| PubChem CID | 100714418 |
| Molecular Formula | C24H32N2OS |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 1-(4-cyclopentyloxyphenyl)-3-[(2R)-4-methyl-4-phenylpentan-2-yl]thiourea |
| SMILES | C[C@H](CC(C)(C)c1ccccc1)NC(=S)Nc1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C24H32N2OS/c1-18(17-24(2,3)19-9-5-4-6-10-19)25-23(28)26-20-13-15-22(16-14-20)27-21-11-7-8-12-21/h4-6,9-10,13-16,18,21H,7-8,11-12,17H2,1-3H3,(H2,25,26,28)/t18-/m1/s1 |
| InChIKey | KYFVOYNNPICXRS-GOSISDBHSA-N |
| XLogP | 6.05 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|