C21H28N2OS — CID 133154922
1-(3-ethoxyphenyl)-3-(4-methyl-4-phenylpentan-2-yl)thiourea (PubChem CID 133154922) has the molecular formula C21H28N2OS and a molecular weight of 356.54 g/mol. Its IUPAC name is 1-(3-ethoxyphenyl)-3-(4-methyl-4-phenylpentan-2-yl)thiourea.
| Compound Name | 1-(3-ethoxyphenyl)-3-(4-methyl-4-phenylpentan-2-yl)thiourea |
|---|---|
| PubChem CID | 133154922 |
| Molecular Formula | C21H28N2OS |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 1-(3-ethoxyphenyl)-3-(4-methyl-4-phenylpentan-2-yl)thiourea |
| SMILES | CCOc1cccc(NC(=S)NC(C)CC(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C21H28N2OS/c1-5-24-19-13-9-12-18(14-19)23-20(25)22-16(2)15-21(3,4)17-10-7-6-8-11-17/h6-14,16H,5,15H2,1-4H3,(H2,22,23,25) |
| InChIKey | YIXCAXJNDDJXID-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|