C16H22N4OS — CID 100618098
1-[3-(dimethylamino)propyl]-3-(8-methoxyquinolin-5-yl)thiourea (PubChem CID 100618098) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-(8-methoxyquinolin-5-yl)thiourea.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-(8-methoxyquinolin-5-yl)thiourea |
|---|---|
| PubChem CID | 100618098 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-(8-methoxyquinolin-5-yl)thiourea |
| SMILES | COc1ccc(NC(=S)NCCCN(C)C)c2cccnc12 |
| InChI | InChI=1S/C16H22N4OS/c1-20(2)11-5-10-18-16(22)19-13-7-8-14(21-3)15-12(13)6-4-9-17-15/h4,6-9H,5,10-11H2,1-3H3,(H2,18,19,22) |
| InChIKey | LYLROMOXTYLXSU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|