C22H28N2S — CID 100765224
1-(3,4-dimethylphenyl)-3-[1-(2-phenylethyl)cyclopentyl]thiourea (PubChem CID 100765224) has the molecular formula C22H28N2S and a molecular weight of 352.55 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[1-(2-phenylethyl)cyclopentyl]thiourea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[1-(2-phenylethyl)cyclopentyl]thiourea |
|---|---|
| PubChem CID | 100765224 |
| Molecular Formula | C22H28N2S |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[1-(2-phenylethyl)cyclopentyl]thiourea |
| SMILES | Cc1ccc(NC(=S)NC2(CCc3ccccc3)CCCC2)cc1C |
| InChI | InChI=1S/C22H28N2S/c1-17-10-11-20(16-18(17)2)23-21(25)24-22(13-6-7-14-22)15-12-19-8-4-3-5-9-19/h3-5,8-11,16H,6-7,12-15H2,1-2H3,(H2,23,24,25) |
| InChIKey | KMSZQDQNKFYRRH-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|