C25H30ClN3OS — CID 100771502
1-[1-[2-(2-chlorophenyl)ethyl]cyclopentyl]-3-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]thiourea (PubChem CID 100771502) has the molecular formula C25H30ClN3OS and a molecular weight of 456.06 g/mol. Its IUPAC name is 1-[1-[2-(2-chlorophenyl)ethyl]cyclopentyl]-3-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]thiourea.
| Compound Name | 1-[1-[2-(2-chlorophenyl)ethyl]cyclopentyl]-3-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 100771502 |
| Molecular Formula | C25H30ClN3OS |
| Molecular Weight | 456.06 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 1-[1-[2-(2-chlorophenyl)ethyl]cyclopentyl]-3-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
| SMILES | Cc1cc(NC(=S)NC2(CCc3ccccc3Cl)CCCC2)ccc1N1CCCC1=O |
| InChI | InChI=1S/C25H30ClN3OS/c1-18-17-20(10-11-22(18)29-16-6-9-23(29)30)27-24(31)28-25(13-4-5-14-25)15-12-19-7-2-3-8-21(19)26/h2-3,7-8,10-11,17H,4-6,9,12-16H2,1H3,(H2,27,28,31) |
| InChIKey | LSYCKBLKJMGMNJ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.06 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|