C21H24FN3OS2 — CID 100622499
1-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]thiourea (PubChem CID 100622499) has the molecular formula C21H24FN3OS2 and a molecular weight of 417.58 g/mol. Its IUPAC name is 1-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]thiourea.
| Compound Name | 1-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 100622499 |
| Molecular Formula | C21H24FN3OS2 |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 1-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-3-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
| SMILES | Cc1cc(NC(=S)NCCSCc2ccccc2F)ccc1N1CCCC1=O |
| InChI | InChI=1S/C21H24FN3OS2/c1-15-13-17(8-9-19(15)25-11-4-7-20(25)26)24-21(27)23-10-12-28-14-16-5-2-3-6-18(16)22/h2-3,5-6,8-9,13H,4,7,10-12,14H2,1H3,(H2,23,24,27) |
| InChIKey | WRSCEJNTYZUVMO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|