C17H17FN2O2S2 — CID 100621618
1-(1,3-benzodioxol-5-yl)-3-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]thiourea (PubChem CID 100621618) has the molecular formula C17H17FN2O2S2 and a molecular weight of 364.47 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]thiourea |
|---|---|
| PubChem CID | 100621618 |
| Molecular Formula | C17H17FN2O2S2 |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]thiourea |
| SMILES | Fc1ccccc1CSCCNC(=S)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H17FN2O2S2/c18-14-4-2-1-3-12(14)10-24-8-7-19-17(23)20-13-5-6-15-16(9-13)22-11-21-15/h1-6,9H,7-8,10-11H2,(H2,19,20,23) |
| InChIKey | BFNSYOMFDGWURQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|