C24H28ClN3OS — CID 100771716
1-[1-[2-(2-chlorophenyl)ethyl]cyclopentyl]-3-[3-(2-oxopyrrolidin-1-yl)phenyl]thiourea (PubChem CID 100771716) has the molecular formula C24H28ClN3OS and a molecular weight of 442.03 g/mol. Its IUPAC name is 1-[1-[2-(2-chlorophenyl)ethyl]cyclopentyl]-3-[3-(2-oxopyrrolidin-1-yl)phenyl]thiourea.
| Compound Name | 1-[1-[2-(2-chlorophenyl)ethyl]cyclopentyl]-3-[3-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 100771716 |
| Molecular Formula | C24H28ClN3OS |
| Molecular Weight | 442.03 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 1-[1-[2-(2-chlorophenyl)ethyl]cyclopentyl]-3-[3-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
| SMILES | O=C1CCCN1c1cccc(NC(=S)NC2(CCc3ccccc3Cl)CCCC2)c1 |
| InChI | InChI=1S/C24H28ClN3OS/c25-21-10-2-1-7-18(21)12-15-24(13-3-4-14-24)27-23(30)26-19-8-5-9-20(17-19)28-16-6-11-22(28)29/h1-2,5,7-10,17H,3-4,6,11-16H2,(H2,26,27,30) |
| InChIKey | CGHJFHDBCHEAST-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.03 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|