C22H25N3OS — CID 133215227
1-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]-3-(1,2,3,4-tetrahydronaphthalen-1-yl)thiourea (PubChem CID 133215227) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is 1-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]-3-(1,2,3,4-tetrahydronaphthalen-1-yl)thiourea.
| Compound Name | 1-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]-3-(1,2,3,4-tetrahydronaphthalen-1-yl)thiourea |
|---|---|
| PubChem CID | 133215227 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 1-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]-3-(1,2,3,4-tetrahydronaphthalen-1-yl)thiourea |
| SMILES | Cc1cc(NC(=S)NC2CCCc3ccccc32)ccc1N1CCCC1=O |
| InChI | InChI=1S/C22H25N3OS/c1-15-14-17(11-12-20(15)25-13-5-10-21(25)26)23-22(27)24-19-9-4-7-16-6-2-3-8-18(16)19/h2-3,6,8,11-12,14,19H,4-5,7,9-10,13H2,1H3,(H2,23,24,27) |
| InChIKey | NQLILNZWHSAPAH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|