C18H18FN3OS — CID 43076593
1-[4-fluoro-3-(2-oxopyrrolidin-1-yl)phenyl]-3-(2-methylphenyl)thiourea (PubChem CID 43076593) has the molecular formula C18H18FN3OS and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-[4-fluoro-3-(2-oxopyrrolidin-1-yl)phenyl]-3-(2-methylphenyl)thiourea.
| Compound Name | 1-[4-fluoro-3-(2-oxopyrrolidin-1-yl)phenyl]-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 43076593 |
| Molecular Formula | C18H18FN3OS |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1-[4-fluoro-3-(2-oxopyrrolidin-1-yl)phenyl]-3-(2-methylphenyl)thiourea |
| SMILES | Cc1ccccc1NC(=S)Nc1ccc(F)c(N2CCCC2=O)c1 |
| InChI | InChI=1S/C18H18FN3OS/c1-12-5-2-3-6-15(12)21-18(24)20-13-8-9-14(19)16(11-13)22-10-4-7-17(22)23/h2-3,5-6,8-9,11H,4,7,10H2,1H3,(H2,20,21,24) |
| InChIKey | BRUMDPSJQLQMFB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|