C19H20FN3O2S — CID 43076208
1-(2-fluorophenyl)-3-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]thiourea (PubChem CID 43076208) has the molecular formula C19H20FN3O2S and a molecular weight of 373.45 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]thiourea.
| Compound Name | 1-(2-fluorophenyl)-3-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 43076208 |
| Molecular Formula | C19H20FN3O2S |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]thiourea |
| SMILES | COc1ccc(NC(=S)Nc2ccccc2F)cc1N1CCCCC1=O |
| InChI | InChI=1S/C19H20FN3O2S/c1-25-17-10-9-13(12-16(17)23-11-5-4-8-18(23)24)21-19(26)22-15-7-3-2-6-14(15)20/h2-3,6-7,9-10,12H,4-5,8,11H2,1H3,(H2,21,22,26) |
| InChIKey | GJLWNRFGKORCET-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|