C27H25N3O4 — CID 55692126
N-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 55692126) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is N-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 55692126 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | N-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2c3ccccc3c(=O)c3ccccc32)cc1N1CCCCC1=O |
| InChI | InChI=1S/C27H25N3O4/c1-34-24-14-13-18(16-23(24)29-15-7-6-12-26(29)32)28-25(31)17-30-21-10-4-2-8-19(21)27(33)20-9-3-5-11-22(20)30/h2-5,8-11,13-14,16H,6-7,12,15,17H2,1H3,(H,28,31) |
| InChIKey | GPAWNUQGAMRMDB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|