C24H30N2O5 — CID 55691944
4-(2-ethoxyphenoxy)-N-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]butanamide (PubChem CID 55691944) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is 4-(2-ethoxyphenoxy)-N-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]butanamide.
| Compound Name | 4-(2-ethoxyphenoxy)-N-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 55691944 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 4-(2-ethoxyphenoxy)-N-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]butanamide |
| SMILES | CCOc1ccccc1OCCCC(=O)Nc1ccc(OC)c(N2CCCCC2=O)c1 |
| InChI | InChI=1S/C24H30N2O5/c1-3-30-21-9-4-5-10-22(21)31-16-8-11-23(27)25-18-13-14-20(29-2)19(17-18)26-15-7-6-12-24(26)28/h4-5,9-10,13-14,17H,3,6-8,11-12,15-16H2,1-2H3,(H,25,27) |
| InChIKey | QAHBPUUDPWKXQT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|