C23H26N2O5 — CID 55741827
4-(4-acetyl-2-methoxyphenoxy)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]butanamide (PubChem CID 55741827) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is 4-(4-acetyl-2-methoxyphenoxy)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]butanamide.
| Compound Name | 4-(4-acetyl-2-methoxyphenoxy)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 55741827 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 4-(4-acetyl-2-methoxyphenoxy)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]butanamide |
| SMILES | COc1cc(C(C)=O)ccc1OCCCC(=O)Nc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C23H26N2O5/c1-16(26)17-7-12-20(21(15-17)29-2)30-14-4-5-22(27)24-18-8-10-19(11-9-18)25-13-3-6-23(25)28/h7-12,15H,3-6,13-14H2,1-2H3,(H,24,27) |
| InChIKey | GNSULCAWCCCWEX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|