C21H23N3O5 — CID 7780107
4-ethoxy-3-methoxy-N'-[4-(2-oxopyrrolidin-1-yl)benzoyl]benzohydrazide (PubChem CID 7780107) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is 4-ethoxy-3-methoxy-N'-[4-(2-oxopyrrolidin-1-yl)benzoyl]benzohydrazide.
| Compound Name | 4-ethoxy-3-methoxy-N'-[4-(2-oxopyrrolidin-1-yl)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 7780107 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 4-ethoxy-3-methoxy-N'-[4-(2-oxopyrrolidin-1-yl)benzoyl]benzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)c2ccc(N3CCCC3=O)cc2)cc1OC |
| InChI | InChI=1S/C21H23N3O5/c1-3-29-17-11-8-15(13-18(17)28-2)21(27)23-22-20(26)14-6-9-16(10-7-14)24-12-4-5-19(24)25/h6-11,13H,3-5,12H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | NPILNBHIPMOTOF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|