C19H22N4O5S — CID 9151613
4-ethoxy-3-methoxy-N'-[2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetyl]benzohydrazide (PubChem CID 9151613) has the molecular formula C19H22N4O5S and a molecular weight of 418.48 g/mol. Its IUPAC name is 4-ethoxy-3-methoxy-N'-[2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetyl]benzohydrazide.
| Compound Name | 4-ethoxy-3-methoxy-N'-[2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 9151613 |
| Molecular Formula | C19H22N4O5S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 4-ethoxy-3-methoxy-N'-[2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetyl]benzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)Cc2csc(N3CCCC3=O)n2)cc1OC |
| InChI | InChI=1S/C19H22N4O5S/c1-3-28-14-7-6-12(9-15(14)27-2)18(26)22-21-16(24)10-13-11-29-19(20-13)23-8-4-5-17(23)25/h6-7,9,11H,3-5,8,10H2,1-2H3,(H,21,24)(H,22,26) |
| InChIKey | HSQUNXJDBFZDQU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|