C17H17ClN4O4S — CID 9278566
5-chloro-2-methoxy-N'-[2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetyl]benzohydrazide (PubChem CID 9278566) has the molecular formula C17H17ClN4O4S and a molecular weight of 408.87 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N'-[2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetyl]benzohydrazide.
| Compound Name | 5-chloro-2-methoxy-N'-[2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 9278566 |
| Molecular Formula | C17H17ClN4O4S |
| Molecular Weight | 408.87 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 5-chloro-2-methoxy-N'-[2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetyl]benzohydrazide |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)Cc1csc(N2CCCC2=O)n1 |
| InChI | InChI=1S/C17H17ClN4O4S/c1-26-13-5-4-10(18)7-12(13)16(25)21-20-14(23)8-11-9-27-17(19-11)22-6-2-3-15(22)24/h4-5,7,9H,2-3,6,8H2,1H3,(H,20,23)(H,21,25) |
| InChIKey | XBWLMSBSSNFIMP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.87 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|