C16H20Cl2N4O3S — CID 119419612
N-(3-amino-4-methoxyphenyl)-2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetamide;dihydrochloride (PubChem CID 119419612) has the molecular formula C16H20Cl2N4O3S and a molecular weight of 419.33 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetamide;dihydrochloride.
| Compound Name | N-(3-amino-4-methoxyphenyl)-2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119419612 |
| Molecular Formula | C16H20Cl2N4O3S |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetamide;dihydrochloride |
| SMILES | COc1ccc(NC(=O)Cc2csc(N3CCCC3=O)n2)cc1N.Cl.Cl |
| InChI | InChI=1S/C16H18N4O3S.2ClH/c1-23-13-5-4-10(7-12(13)17)18-14(21)8-11-9-24-16(19-11)20-6-2-3-15(20)22;;/h4-5,7,9H,2-3,6,8,17H2,1H3,(H,18,21);2*1H |
| InChIKey | SSKPESULEWHFQF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|