C20H22F2N2O2 — CID 99807501
1-[5-[[(1S)-1-(2,6-difluorophenyl)ethyl]amino]-2-methoxyphenyl]piperidin-2-one (PubChem CID 99807501) has the molecular formula C20H22F2N2O2 and a molecular weight of 360.40 g/mol. Its IUPAC name is 1-[5-[[(1S)-1-(2,6-difluorophenyl)ethyl]amino]-2-methoxyphenyl]piperidin-2-one.
| Compound Name | 1-[5-[[(1S)-1-(2,6-difluorophenyl)ethyl]amino]-2-methoxyphenyl]piperidin-2-one |
|---|---|
| PubChem CID | 99807501 |
| Molecular Formula | C20H22F2N2O2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-[5-[[(1S)-1-(2,6-difluorophenyl)ethyl]amino]-2-methoxyphenyl]piperidin-2-one |
| SMILES | COc1ccc(N[C@@H](C)c2c(F)cccc2F)cc1N1CCCCC1=O |
| InChI | InChI=1S/C20H22F2N2O2/c1-13(20-15(21)6-5-7-16(20)22)23-14-9-10-18(26-2)17(12-14)24-11-4-3-8-19(24)25/h5-7,9-10,12-13,23H,3-4,8,11H2,1-2H3/t13-/m0/s1 |
| InChIKey | UDOFWWAGIRIVKE-ZDUSSCGKSA-N |
| XLogP | 4.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|