C19H22F2N2O4S — CID 97020537
N-[(1S)-1-(2,6-difluorophenyl)ethyl]-4-methoxy-3-morpholin-4-ylsulfonylaniline (PubChem CID 97020537) has the molecular formula C19H22F2N2O4S and a molecular weight of 412.46 g/mol. Its IUPAC name is N-[(1S)-1-(2,6-difluorophenyl)ethyl]-4-methoxy-3-morpholin-4-ylsulfonylaniline.
| Compound Name | N-[(1S)-1-(2,6-difluorophenyl)ethyl]-4-methoxy-3-morpholin-4-ylsulfonylaniline |
|---|---|
| PubChem CID | 97020537 |
| Molecular Formula | C19H22F2N2O4S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-[(1S)-1-(2,6-difluorophenyl)ethyl]-4-methoxy-3-morpholin-4-ylsulfonylaniline |
| SMILES | COc1ccc(N[C@@H](C)c2c(F)cccc2F)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H22F2N2O4S/c1-13(19-15(20)4-3-5-16(19)21)22-14-6-7-17(26-2)18(12-14)28(24,25)23-8-10-27-11-9-23/h3-7,12-13,22H,8-11H2,1-2H3/t13-/m0/s1 |
| InChIKey | NLSFAYZLJPIFDQ-ZDUSSCGKSA-N |
| XLogP | 3.17 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|