C18H20N2O8S2 — CID 5176528
3-[(4-methoxy-3-morpholin-4-ylsulfonylphenyl)sulfamoyl]benzoic acid (PubChem CID 5176528) has the molecular formula C18H20N2O8S2 and a molecular weight of 456.50 g/mol. Its IUPAC name is 3-[(4-methoxy-3-morpholin-4-ylsulfonylphenyl)sulfamoyl]benzoic acid.
| Compound Name | 3-[(4-methoxy-3-morpholin-4-ylsulfonylphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 5176528 |
| Molecular Formula | C18H20N2O8S2 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 3-[(4-methoxy-3-morpholin-4-ylsulfonylphenyl)sulfamoyl]benzoic acid |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)O)c2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C18H20N2O8S2/c1-27-16-6-5-14(12-17(16)30(25,26)20-7-9-28-10-8-20)19-29(23,24)15-4-2-3-13(11-15)18(21)22/h2-6,11-12,19H,7-10H2,1H3,(H,21,22) |
| InChIKey | WXEQWXGBBBBVCL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |