C19H22N2O6S2 — CID 3263059
3-[(4-methyl-3-piperidin-1-ylsulfonylphenyl)sulfamoyl]benzoic acid (PubChem CID 3263059) has the molecular formula C19H22N2O6S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 3-[(4-methyl-3-piperidin-1-ylsulfonylphenyl)sulfamoyl]benzoic acid.
| Compound Name | 3-[(4-methyl-3-piperidin-1-ylsulfonylphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 3263059 |
| Molecular Formula | C19H22N2O6S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 3-[(4-methyl-3-piperidin-1-ylsulfonylphenyl)sulfamoyl]benzoic acid |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc(C(=O)O)c2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H22N2O6S2/c1-14-8-9-16(13-18(14)29(26,27)21-10-3-2-4-11-21)20-28(24,25)17-7-5-6-15(12-17)19(22)23/h5-9,12-13,20H,2-4,10-11H2,1H3,(H,22,23) |
| InChIKey | YMLMYXBVDNYSSC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |