C21H28N2O6S2 — CID 30867486
4-(2-methoxyethoxy)-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)benzenesulfonamide (PubChem CID 30867486) has the molecular formula C21H28N2O6S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)benzenesulfonamide.
| Compound Name | 4-(2-methoxyethoxy)-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 30867486 |
| Molecular Formula | C21H28N2O6S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 4-(2-methoxyethoxy)-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)benzenesulfonamide |
| SMILES | COCCOc1ccc(S(=O)(=O)Nc2ccc(C)c(S(=O)(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C21H28N2O6S2/c1-17-6-7-18(16-21(17)31(26,27)23-12-4-3-5-13-23)22-30(24,25)20-10-8-19(9-11-20)29-15-14-28-2/h6-11,16,22H,3-5,12-15H2,1-2H3 |
| InChIKey | AYPBKCUPYZVFQD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|