C18H20N2O6S — CID 110613237
3-[(2-methoxy-5-morpholin-4-ylphenyl)sulfamoyl]benzoic acid (PubChem CID 110613237) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is 3-[(2-methoxy-5-morpholin-4-ylphenyl)sulfamoyl]benzoic acid.
| Compound Name | 3-[(2-methoxy-5-morpholin-4-ylphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 110613237 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 3-[(2-methoxy-5-morpholin-4-ylphenyl)sulfamoyl]benzoic acid |
| SMILES | COc1ccc(N2CCOCC2)cc1NS(=O)(=O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C18H20N2O6S/c1-25-17-6-5-14(20-7-9-26-10-8-20)12-16(17)19-27(23,24)15-4-2-3-13(11-15)18(21)22/h2-6,11-12,19H,7-10H2,1H3,(H,21,22) |
| InChIKey | PNEATYBYYHIYDN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|