C20H26N2O4S — CID 110359825
N-(2-methoxy-5-morpholin-4-ylphenyl)-2,4,6-trimethylbenzenesulfonamide (PubChem CID 110359825) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is N-(2-methoxy-5-morpholin-4-ylphenyl)-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-(2-methoxy-5-morpholin-4-ylphenyl)-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 110359825 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-(2-methoxy-5-morpholin-4-ylphenyl)-2,4,6-trimethylbenzenesulfonamide |
| SMILES | COc1ccc(N2CCOCC2)cc1NS(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C20H26N2O4S/c1-14-11-15(2)20(16(3)12-14)27(23,24)21-18-13-17(5-6-19(18)25-4)22-7-9-26-10-8-22/h5-6,11-13,21H,7-10H2,1-4H3 |
| InChIKey | NDAXJRRFBPYXKS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|