C20H22N2O8S2 — CID 4533150
3-[4-[(4-methoxy-3-morpholin-4-ylsulfonylphenyl)sulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 4533150) has the molecular formula C20H22N2O8S2 and a molecular weight of 482.54 g/mol. Its IUPAC name is 3-[4-[(4-methoxy-3-morpholin-4-ylsulfonylphenyl)sulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[(4-methoxy-3-morpholin-4-ylsulfonylphenyl)sulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 4533150 |
| Molecular Formula | C20H22N2O8S2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 3-[4-[(4-methoxy-3-morpholin-4-ylsulfonylphenyl)sulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(C=CC(=O)O)cc2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H22N2O8S2/c1-29-18-8-5-16(14-19(18)32(27,28)22-10-12-30-13-11-22)21-31(25,26)17-6-2-15(3-7-17)4-9-20(23)24/h2-9,14,21H,10-13H2,1H3,(H,23,24) |
| InChIKey | JJTVSIHUUBUTSD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|