C16H20N2O6S — CID 71902676
3-[3-(4-acetylpiperazin-1-yl)sulfonyl-4-methoxyphenyl]prop-2-enoic acid (PubChem CID 71902676) has the molecular formula C16H20N2O6S and a molecular weight of 368.41 g/mol. Its IUPAC name is 3-[3-(4-acetylpiperazin-1-yl)sulfonyl-4-methoxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[3-(4-acetylpiperazin-1-yl)sulfonyl-4-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71902676 |
| Molecular Formula | C16H20N2O6S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 3-[3-(4-acetylpiperazin-1-yl)sulfonyl-4-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1ccc(C=CC(=O)O)cc1S(=O)(=O)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C16H20N2O6S/c1-12(19)17-7-9-18(10-8-17)25(22,23)15-11-13(4-6-16(20)21)3-5-14(15)24-2/h3-6,11H,7-10H2,1-2H3,(H,20,21) |
| InChIKey | NUMHLYZWEDYCQS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|